C27H32F3N3O — CID 98624140
(4aS,5S)-3-benzyl-N-cyclohexyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 98624140) has the molecular formula C27H32F3N3O and a molecular weight of 471.57 g/mol. Its IUPAC name is (4aS,5S)-3-benzyl-N-cyclohexyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-3-benzyl-N-cyclohexyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 98624140 |
| Molecular Formula | C27H32F3N3O |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (4aS,5S)-3-benzyl-N-cyclohexyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(Cc3ccccc3)C[C@H]12 |
| InChI | InChI=1S/C27H32F3N3O/c28-27(29,30)21-11-12-24-20(15-21)16-23(26(34)31-22-9-5-2-6-10-22)25-18-32(13-14-33(24)25)17-19-7-3-1-4-8-19/h1,3-4,7-8,11-12,15,22-23,25H,2,5-6,9-10,13-14,16-18H2,(H,31,34)/t23-,25+/m0/s1 |
| InChIKey | BCYNWSGEAWBBGC-UKILVPOCSA-N |
| XLogP | 5.02 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |