C22H23F3N2O — CID 99732433
(4aS,5S)-N-benzyl-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxamide (PubChem CID 99732433) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (4aS,5S)-N-benzyl-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxamide.
| Compound Name | (4aS,5S)-N-benzyl-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxamide |
|---|---|
| PubChem CID | 99732433 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (4aS,5S)-N-benzyl-8-(trifluoromethyl)-2,3,4,4a,5,6-hexahydro-1H-benzo[c]quinolizine-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCCC[C@@H]12 |
| InChI | InChI=1S/C22H23F3N2O/c23-22(24,25)17-9-10-19-16(12-17)13-18(20-8-4-5-11-27(19)20)21(28)26-14-15-6-2-1-3-7-15/h1-3,6-7,9-10,12,18,20H,4-5,8,11,13-14H2,(H,26,28)/t18-,20-/m0/s1 |
| InChIKey | VCQUXJSHRXOCGJ-ICSRJNTNSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |