C29H29F4N3O — CID 42801213
N-[(3-fluorophenyl)methyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42801213) has the molecular formula C29H29F4N3O and a molecular weight of 511.56 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42801213 |
| Molecular Formula | C29H29F4N3O |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1cccc(F)c1)C1Cc2cc(C(F)(F)F)ccc2N2CCN(CCc3ccccc3)CC12 |
| InChI | InChI=1S/C29H29F4N3O/c30-24-8-4-7-21(15-24)18-34-28(37)25-17-22-16-23(29(31,32)33)9-10-26(22)36-14-13-35(19-27(25)36)12-11-20-5-2-1-3-6-20/h1-10,15-16,25,27H,11-14,17-19H2,(H,34,37) |
| InChIKey | JBKKEKDXGKZKHC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |