C29H30F3N3O2 — CID 99730172
(4aR,5S)-N-(3-methoxyphenyl)-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99730172) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is (4aR,5S)-N-(3-methoxyphenyl)-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-(3-methoxyphenyl)-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99730172 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (4aR,5S)-N-(3-methoxyphenyl)-3-(2-phenylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1cccc(NC(=O)[C@H]2Cc3cc(C(F)(F)F)ccc3N3CCN(CCc4ccccc4)C[C@@H]23)c1 |
| InChI | InChI=1S/C29H30F3N3O2/c1-37-24-9-5-8-23(18-24)33-28(36)25-17-21-16-22(29(30,31)32)10-11-26(21)35-15-14-34(19-27(25)35)13-12-20-6-3-2-4-7-20/h2-11,16,18,25,27H,12-15,17,19H2,1H3,(H,33,36)/t25-,27-/m0/s1 |
| InChIKey | YAFRJORLWKGUDR-BDYUSTAISA-N |
| XLogP | 5.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |