C27H25F4N3O2 — CID 129428011
(4aS,5R)-N-(4-fluorophenyl)-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 129428011) has the molecular formula C27H25F4N3O2 and a molecular weight of 499.51 g/mol. Its IUPAC name is (4aS,5R)-N-(4-fluorophenyl)-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-(4-fluorophenyl)-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129428011 |
| Molecular Formula | C27H25F4N3O2 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (4aS,5R)-N-(4-fluorophenyl)-3-(4-methoxyphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(N2CCN3c4ccc(C(F)(F)F)cc4C[C@@H](C(=O)Nc4ccc(F)cc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C27H25F4N3O2/c1-36-22-9-7-21(8-10-22)33-12-13-34-24-11-2-18(27(29,30)31)14-17(24)15-23(25(34)16-33)26(35)32-20-5-3-19(28)4-6-20/h2-11,14,23,25H,12-13,15-16H2,1H3,(H,32,35)/t23-,25-/m1/s1 |
| InChIKey | ICMTTYCHJCPPFC-ILBGXUMGSA-N |
| XLogP | 5.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|