C27H25F4N3O — CID 129427359
(4aS,5S)-N-(4-fluorophenyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 129427359) has the molecular formula C27H25F4N3O and a molecular weight of 483.51 g/mol. Its IUPAC name is (4aS,5S)-N-(4-fluorophenyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5S)-N-(4-fluorophenyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 129427359 |
| Molecular Formula | C27H25F4N3O |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (4aS,5S)-N-(4-fluorophenyl)-3-(4-methylphenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | Cc1ccc(N2CCN3c4ccc(C(F)(F)F)cc4C[C@H](C(=O)Nc4ccc(F)cc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C27H25F4N3O/c1-17-2-9-22(10-3-17)33-12-13-34-24-11-4-19(27(29,30)31)14-18(24)15-23(25(34)16-33)26(35)32-21-7-5-20(28)6-8-21/h2-11,14,23,25H,12-13,15-16H2,1H3,(H,32,35)/t23-,25+/m0/s1 |
| InChIKey | BZHBQZWJZNZPQO-UKILVPOCSA-N |
| XLogP | 5.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|