C27H25F4N3O — CID 99728632
(4aR,5R)-N-[(4-fluorophenyl)methyl]-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99728632) has the molecular formula C27H25F4N3O and a molecular weight of 483.51 g/mol. Its IUPAC name is (4aR,5R)-N-[(4-fluorophenyl)methyl]-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-[(4-fluorophenyl)methyl]-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99728632 |
| Molecular Formula | C27H25F4N3O |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (4aR,5R)-N-[(4-fluorophenyl)methyl]-3-phenyl-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(c3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C27H25F4N3O/c28-21-9-6-18(7-10-21)16-32-26(35)23-15-19-14-20(27(29,30)31)8-11-24(19)34-13-12-33(17-25(23)34)22-4-2-1-3-5-22/h1-11,14,23,25H,12-13,15-17H2,(H,32,35)/t23-,25+/m1/s1 |
| InChIKey | DMBZCESQBFQVSO-NOZRDPDXSA-N |
| XLogP | 5.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |