C28H30F3N3OS — CID 93123658
(4aR,5S)-3-(2-phenylethyl)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123658) has the molecular formula C28H30F3N3OS and a molecular weight of 513.63 g/mol. Its IUPAC name is (4aR,5S)-3-(2-phenylethyl)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-(2-phenylethyl)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123658 |
| Molecular Formula | C28H30F3N3OS |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (4aR,5S)-3-(2-phenylethyl)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCc1cccs1)[C@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(CCc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C28H30F3N3OS/c29-28(30,31)22-8-9-25-21(17-22)18-24(27(35)32-12-10-23-7-4-16-36-23)26-19-33(14-15-34(25)26)13-11-20-5-2-1-3-6-20/h1-9,16-17,24,26H,10-15,18-19H2,(H,32,35)/t24-,26-/m0/s1 |
| InChIKey | XCNDMYKLQOKWQU-AHWVRZQESA-N |
| XLogP | 5.03 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |