C20H21F3N2OS2 — CID 93123548
(4aS,5R)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide (PubChem CID 93123548) has the molecular formula C20H21F3N2OS2 and a molecular weight of 426.53 g/mol. Its IUPAC name is (4aS,5R)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123548 |
| Molecular Formula | C20H21F3N2OS2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | (4aS,5R)-N-(2-thiophen-2-ylethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCc1cccs1)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCSC[C@H]12 |
| InChI | InChI=1S/C20H21F3N2OS2/c21-20(22,23)14-3-4-17-13(10-14)11-16(18-12-27-9-7-25(17)18)19(26)24-6-5-15-2-1-8-28-15/h1-4,8,10,16,18H,5-7,9,11-12H2,(H,24,26)/t16-,18-/m1/s1 |
| InChIKey | ITRZNZBDOVUYSS-SJLPKXTDSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |