C21H28F3N3O2S — CID 93123543
(4aR,5R)-N-(3-morpholin-4-ylpropyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide (PubChem CID 93123543) has the molecular formula C21H28F3N3O2S and a molecular weight of 443.54 g/mol. Its IUPAC name is (4aR,5R)-N-(3-morpholin-4-ylpropyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-(3-morpholin-4-ylpropyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123543 |
| Molecular Formula | C21H28F3N3O2S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (4aR,5R)-N-(3-morpholin-4-ylpropyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCSC[C@@H]12 |
| InChI | InChI=1S/C21H28F3N3O2S/c22-21(23,24)16-2-3-18-15(12-16)13-17(19-14-30-11-8-27(18)19)20(28)25-4-1-5-26-6-9-29-10-7-26/h2-3,12,17,19H,1,4-11,13-14H2,(H,25,28)/t17-,19+/m1/s1 |
| InChIKey | MSFHIFDTGPGSFL-MJGOQNOKSA-N |
| XLogP | 2.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|