C19H25F3N2OS — CID 93123550
(4aS,5R)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide (PubChem CID 93123550) has the molecular formula C19H25F3N2OS and a molecular weight of 386.48 g/mol. Its IUPAC name is (4aS,5R)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123550 |
| Molecular Formula | C19H25F3N2OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (4aS,5R)-N-(3-methylbutyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
| SMILES | CC(C)CCNC(=O)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCSC[C@H]12 |
| InChI | InChI=1S/C19H25F3N2OS/c1-12(2)5-6-23-18(25)15-10-13-9-14(19(20,21)22)3-4-16(13)24-7-8-26-11-17(15)24/h3-4,9,12,15,17H,5-8,10-11H2,1-2H3,(H,23,25)/t15-,17-/m1/s1 |
| InChIKey | DOIMFSKWGDFTQZ-NVXWUHKLSA-N |
| XLogP | 3.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |