C24H27F3N2O3S — CID 42803719
N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide (PubChem CID 42803719) has the molecular formula C24H27F3N2O3S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803719 |
| Molecular Formula | C24H27F3N2O3S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydro-[1,4]thiazino[4,3-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2Cc3cc(C(F)(F)F)ccc3N3CCSCC23)cc1OC |
| InChI | InChI=1S/C24H27F3N2O3S/c1-31-21-6-3-15(11-22(21)32-2)7-8-28-23(30)18-13-16-12-17(24(25,26)27)4-5-19(16)29-9-10-33-14-20(18)29/h3-6,11-12,18,20H,7-10,13-14H2,1-2H3,(H,28,30) |
| InChIKey | GYCMGAIOTGNMDY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |