C30H31F4N3O3 — CID 42803683
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42803683) has the molecular formula C30H31F4N3O3 and a molecular weight of 557.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42803683 |
| Molecular Formula | C30H31F4N3O3 |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-fluorophenyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2Cc3cc(C(F)(F)F)ccc3N3CCN(c4ccccc4F)CC23)cc1OC |
| InChI | InChI=1S/C30H31F4N3O3/c1-39-27-10-7-19(15-28(27)40-2)11-12-35-29(38)22-17-20-16-21(30(32,33)34)8-9-24(20)37-14-13-36(18-26(22)37)25-6-4-3-5-23(25)31/h3-10,15-16,22,26H,11-14,17-18H2,1-2H3,(H,35,38) |
| InChIKey | RELHLUGQUZQHEC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |