C26H23F4N3O3 — CID 99730230
(4aR,5R)-N-[(2-fluorophenyl)methyl]-3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99730230) has the molecular formula C26H23F4N3O3 and a molecular weight of 501.48 g/mol. Its IUPAC name is (4aR,5R)-N-[(2-fluorophenyl)methyl]-3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-N-[(2-fluorophenyl)methyl]-3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99730230 |
| Molecular Formula | C26H23F4N3O3 |
| Molecular Weight | 501.48 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | (4aR,5R)-N-[(2-fluorophenyl)methyl]-3-(furan-2-carbonyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccccc1F)[C@@H]1Cc2cc(C(F)(F)F)ccc2N2CCN(C(=O)c3ccco3)C[C@@H]12 |
| InChI | InChI=1S/C26H23F4N3O3/c27-20-5-2-1-4-16(20)14-31-24(34)19-13-17-12-18(26(28,29)30)7-8-21(17)33-10-9-32(15-22(19)33)25(35)23-6-3-11-36-23/h1-8,11-12,19,22H,9-10,13-15H2,(H,31,34)/t19-,22+/m1/s1 |
| InChIKey | DANFEUPSAHOPQR-KNQAVFIVSA-N |
| XLogP | 4.26 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |