C25H23F3N4O3 — CID 42801098
3-(furan-2-carbonyl)-N-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 42801098) has the molecular formula C25H23F3N4O3 and a molecular weight of 484.48 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-N-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | 3-(furan-2-carbonyl)-N-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 42801098 |
| Molecular Formula | C25H23F3N4O3 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-(furan-2-carbonyl)-N-(pyridin-2-ylmethyl)-8-(trifluoromethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1Cc2cc(C(F)(F)F)ccc2N2CCN(C(=O)c3ccco3)CC12 |
| InChI | InChI=1S/C25H23F3N4O3/c26-25(27,28)17-6-7-20-16(12-17)13-19(23(33)30-14-18-4-1-2-8-29-18)21-15-31(9-10-32(20)21)24(34)22-5-3-11-35-22/h1-8,11-12,19,21H,9-10,13-15H2,(H,30,33) |
| InChIKey | OKFWHRCWZKWMFB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |