C16H20N4O5 — CID 142880033
(4S)-4-methyl-N-(methylcarbamoyl)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide (PubChem CID 142880033) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is (4S)-4-methyl-N-(methylcarbamoyl)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide.
| Compound Name | (4S)-4-methyl-N-(methylcarbamoyl)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 142880033 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (4S)-4-methyl-N-(methylcarbamoyl)-8-nitro-1,2,4,4a,5,6-hexahydro-[1,4]oxazino[4,3-a]quinoline-5-carboxamide |
| SMILES | CNC(=O)NC(=O)C1Cc2cc([N+](=O)[O-])ccc2N2CCO[C@@H](C)C12 |
| InChI | InChI=1S/C16H20N4O5/c1-9-14-12(15(21)18-16(22)17-2)8-10-7-11(20(23)24)3-4-13(10)19(14)5-6-25-9/h3-4,7,9,12,14H,5-6,8H2,1-2H3,(H2,17,18,21,22)/t9-,12?,14?/m0/s1 |
| InChIKey | OGVNQDJMGIMQLD-VOALNZTBSA-N |
| XLogP | 0.82 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|