C23H32N4O4 — CID 93123297
(4aR,5S)-3-cyclopentyl-8-nitro-N-[[(2S)-oxolan-2-yl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123297) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is (4aR,5S)-3-cyclopentyl-8-nitro-N-[[(2S)-oxolan-2-yl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-3-cyclopentyl-8-nitro-N-[[(2S)-oxolan-2-yl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123297 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (4aR,5S)-3-cyclopentyl-8-nitro-N-[[(2S)-oxolan-2-yl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)[C@H]1Cc2cc([N+](=O)[O-])ccc2N2CCN(C3CCCC3)C[C@@H]12 |
| InChI | InChI=1S/C23H32N4O4/c28-23(24-14-19-6-3-11-31-19)20-13-16-12-18(27(29)30)7-8-21(16)26-10-9-25(15-22(20)26)17-4-1-2-5-17/h7-8,12,17,19-20,22H,1-6,9-11,13-15H2,(H,24,28)/t19-,20-,22-/m0/s1 |
| InChIKey | GZWSQYUSRHVIJX-ONTIZHBOSA-N |
| XLogP | 2.50 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|