C21H31N5O4 — CID 93123213
(4aR,5S)-8-nitro-3-[2-oxo-2-(propan-2-ylamino)ethyl]-N-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93123213) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (4aR,5S)-8-nitro-3-[2-oxo-2-(propan-2-ylamino)ethyl]-N-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-8-nitro-3-[2-oxo-2-(propan-2-ylamino)ethyl]-N-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93123213 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (4aR,5S)-8-nitro-3-[2-oxo-2-(propan-2-ylamino)ethyl]-N-propan-2-yl-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)NC(=O)CN1CCN2c3ccc([N+](=O)[O-])cc3C[C@H](C(=O)NC(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C21H31N5O4/c1-13(2)22-20(27)12-24-7-8-25-18-6-5-16(26(29)30)9-15(18)10-17(19(25)11-24)21(28)23-14(3)4/h5-6,9,13-14,17,19H,7-8,10-12H2,1-4H3,(H,22,27)(H,23,28)/t17-,19-/m0/s1 |
| InChIKey | XNXIIORTNVDXJI-HKUYNNGSSA-N |
| XLogP | 1.31 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|