C23H33N5O4 — CID 99728382
(4aR,5S)-N-(2-methylpropyl)-8-nitro-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 99728382) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is (4aR,5S)-N-(2-methylpropyl)-8-nitro-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-(2-methylpropyl)-8-nitro-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 99728382 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | (4aR,5S)-N-(2-methylpropyl)-8-nitro-3-(2-oxo-2-pyrrolidin-1-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | CC(C)CNC(=O)[C@H]1Cc2cc([N+](=O)[O-])ccc2N2CCN(CC(=O)N3CCCC3)C[C@@H]12 |
| InChI | InChI=1S/C23H33N5O4/c1-16(2)13-24-23(30)19-12-17-11-18(28(31)32)5-6-20(17)27-10-9-25(14-21(19)27)15-22(29)26-7-3-4-8-26/h5-6,11,16,19,21H,3-4,7-10,12-15H2,1-2H3,(H,24,30)/t19-,21-/m0/s1 |
| InChIKey | QCSKGLJYIDOOPA-FPOVZHCZSA-N |
| XLogP | 1.65 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|