C9H11N3O2 — CID 154151667
2-methyl-5-nitro-2,3-dihydroindol-1-amine (PubChem CID 154151667) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2-methyl-5-nitro-2,3-dihydroindol-1-amine.
| Compound Name | 2-methyl-5-nitro-2,3-dihydroindol-1-amine |
|---|---|
| PubChem CID | 154151667 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-methyl-5-nitro-2,3-dihydroindol-1-amine |
| SMILES | CC1Cc2cc([N+](=O)[O-])ccc2N1N |
| InChI | InChI=1S/C9H11N3O2/c1-6-4-7-5-8(12(13)14)2-3-9(7)11(6)10/h2-3,5-6H,4,10H2,1H3 |
| InChIKey | UTRXAJBYEMNDDX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|