C10H9NO3 — CID 124630134
(2R)-2-methyl-5-nitro-2,3-dihydroinden-1-one (PubChem CID 124630134) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is (2R)-2-methyl-5-nitro-2,3-dihydroinden-1-one.
| Compound Name | (2R)-2-methyl-5-nitro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 124630134 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (2R)-2-methyl-5-nitro-2,3-dihydroinden-1-one |
| SMILES | C[C@@H]1Cc2cc([N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C10H9NO3/c1-6-4-7-5-8(11(13)14)2-3-9(7)10(6)12/h2-3,5-6H,4H2,1H3/t6-/m1/s1 |
| InChIKey | ZSOMFYZHUCMIIJ-ZCFIWIBFSA-N |
| XLogP | 1.97 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|