C10H13N2O2+ — CID 132599419
(3R)-3-methyl-7-nitro-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 132599419) has the molecular formula C10H13N2O2+ and a molecular weight of 193.23 g/mol. Its IUPAC name is (3R)-3-methyl-7-nitro-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | (3R)-3-methyl-7-nitro-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 132599419 |
| Molecular Formula | C10H13N2O2+ |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | (3R)-3-methyl-7-nitro-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | C[C@@H]1Cc2ccc([N+](=O)[O-])cc2C[NH2+]1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-4-8-2-3-10(12(13)14)5-9(8)6-11-7/h2-3,5,7,11H,4,6H2,1H3/p+1/t7-/m1/s1 |
| InChIKey | OTVSEAHLIUCIKT-SSDOTTSWSA-O |
| XLogP | 0.60 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|