C19H24N2O4 — CID 11910623
(1S,10S,11R,12R)-12,14,14-trimethyl-6-nitro-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene-10-carboxylic acid (PubChem CID 11910623) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,10S,11R,12R)-12,14,14-trimethyl-6-nitro-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene-10-carboxylic acid.
| Compound Name | (1S,10S,11R,12R)-12,14,14-trimethyl-6-nitro-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene-10-carboxylic acid |
|---|---|
| PubChem CID | 11910623 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (1S,10S,11R,12R)-12,14,14-trimethyl-6-nitro-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene-10-carboxylic acid |
| SMILES | CC1(C)C[C@H]2C[C@@](C)(C1)[C@H]1[C@@H](C(=O)O)Cc3cc([N+](=O)[O-])ccc3N21 |
| InChI | InChI=1S/C19H24N2O4/c1-18(2)8-13-9-19(3,10-18)16-14(17(22)23)7-11-6-12(21(24)25)4-5-15(11)20(13)16/h4-6,13-14,16H,7-10H2,1-3H3,(H,22,23)/t13-,14-,16+,19-/m0/s1 |
| InChIKey | OWUSYBWTCKRERJ-BFIPOCKSSA-N |
| XLogP | 3.63 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|