C14H16N2O6 — CID 7598483
(2R)-1-ethyl-2-methyl-6-nitro-2,4-dihydroquinoline-3,3-dicarboxylic acid (PubChem CID 7598483) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2R)-1-ethyl-2-methyl-6-nitro-2,4-dihydroquinoline-3,3-dicarboxylic acid.
| Compound Name | (2R)-1-ethyl-2-methyl-6-nitro-2,4-dihydroquinoline-3,3-dicarboxylic acid |
|---|---|
| PubChem CID | 7598483 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R)-1-ethyl-2-methyl-6-nitro-2,4-dihydroquinoline-3,3-dicarboxylic acid |
| SMILES | CCN1c2ccc([N+](=O)[O-])cc2CC(C(=O)O)(C(=O)O)[C@H]1C |
| InChI | InChI=1S/C14H16N2O6/c1-3-15-8(2)14(12(17)18,13(19)20)7-9-6-10(16(21)22)4-5-11(9)15/h4-6,8H,3,7H2,1-2H3,(H,17,18)(H,19,20)/t8-/m1/s1 |
| InChIKey | ORHJVZANKSCEIV-MRVPVSSYSA-N |
| XLogP | 1.52 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|