C17H21N5O5 — CID 56504124
N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)acetamide (PubChem CID 56504124) has the molecular formula C17H21N5O5 and a molecular weight of 375.39 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)acetamide.
| Compound Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)acetamide |
|---|---|
| PubChem CID | 56504124 |
| Molecular Formula | C17H21N5O5 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(2-methyl-5-nitro-2,3-dihydroindol-1-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CN2c3ccc([N+](=O)[O-])cc3CC2C)C1=O |
| InChI | InChI=1S/C17H21N5O5/c1-4-17(3)15(24)21(16(25)18-17)19-14(23)9-20-10(2)7-11-8-12(22(26)27)5-6-13(11)20/h5-6,8,10H,4,7,9H2,1-3H3,(H,18,25)(H,19,23) |
| InChIKey | GHGCLETYGBUWFP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|