C13H23N5O5S — CID 55436806
N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 55436806) has the molecular formula C13H23N5O5S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 55436806 |
| Molecular Formula | C13H23N5O5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CN2CCN(S(C)(=O)=O)CC2)C1=O |
| InChI | InChI=1S/C13H23N5O5S/c1-4-13(2)11(20)18(12(21)14-13)15-10(19)9-16-5-7-17(8-6-16)24(3,22)23/h4-9H2,1-3H3,(H,14,21)(H,15,19) |
| InChIKey | NZJJRBIDMJKSLO-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|