C25H29F2N5O3 — CID 43013052
2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 43013052) has the molecular formula C25H29F2N5O3 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43013052 |
| Molecular Formula | C25H29F2N5O3 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CN2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C25H29F2N5O3/c1-3-25(2)23(34)32(24(35)28-25)29-21(33)16-30-12-14-31(15-13-30)22(17-4-8-19(26)9-5-17)18-6-10-20(27)11-7-18/h4-11,22H,3,12-16H2,1-2H3,(H,28,35)(H,29,33) |
| InChIKey | YQKNUIGNESZNQI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|