C14H23N5O4 — CID 43012937
2-(4-acetylpiperazin-1-yl)-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 43012937) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 43012937 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(C)NC(=O)N(NC(=O)CN2CCN(C(C)=O)CC2)C1=O |
| InChI | InChI=1S/C14H23N5O4/c1-4-14(3)12(22)19(13(23)15-14)16-11(21)9-17-5-7-18(8-6-17)10(2)20/h4-9H2,1-3H3,(H,15,23)(H,16,21) |
| InChIKey | PTWXDJOZOPDHEK-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|