C22H22N2O6 — CID 7660261
(2'R)-1'-ethyl-2,2-dimethyl-6'-nitro-2'-phenylspiro[1,3-dioxane-5,3'-2,4-dihydroquinoline]-4,6-dione (PubChem CID 7660261) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is (2'R)-1'-ethyl-2,2-dimethyl-6'-nitro-2'-phenylspiro[1,3-dioxane-5,3'-2,4-dihydroquinoline]-4,6-dione.
| Compound Name | (2'R)-1'-ethyl-2,2-dimethyl-6'-nitro-2'-phenylspiro[1,3-dioxane-5,3'-2,4-dihydroquinoline]-4,6-dione |
|---|---|
| PubChem CID | 7660261 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2'R)-1'-ethyl-2,2-dimethyl-6'-nitro-2'-phenylspiro[1,3-dioxane-5,3'-2,4-dihydroquinoline]-4,6-dione |
| SMILES | CCN1c2ccc([N+](=O)[O-])cc2CC2(C(=O)OC(C)(C)OC2=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H22N2O6/c1-4-23-17-11-10-16(24(27)28)12-15(17)13-22(18(23)14-8-6-5-7-9-14)19(25)29-21(2,3)30-20(22)26/h5-12,18H,4,13H2,1-3H3/t18-/m1/s1 |
| InChIKey | OADANPYOHMPFFJ-GOSISDBHSA-N |
| XLogP | 3.54 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|