C14H13N3O3S — CID 56825575
(2-methyl-5-nitro-2,3-dihydroindol-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 56825575) has the molecular formula C14H13N3O3S and a molecular weight of 303.34 g/mol. Its IUPAC name is (2-methyl-5-nitro-2,3-dihydroindol-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | (2-methyl-5-nitro-2,3-dihydroindol-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 56825575 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2-methyl-5-nitro-2,3-dihydroindol-1-yl)-(4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1ncsc1C(=O)N1c2ccc([N+](=O)[O-])cc2CC1C |
| InChI | InChI=1S/C14H13N3O3S/c1-8-5-10-6-11(17(19)20)3-4-12(10)16(8)14(18)13-9(2)15-7-21-13/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | KDGQAXLPPXTFDE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|