C17H14N4O3 — CID 35414080
[(2R)-2-methyl-2,3-dihydroindol-1-yl]-(5-nitro-1H-indazol-3-yl)methanone (PubChem CID 35414080) has the molecular formula C17H14N4O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is [(2R)-2-methyl-2,3-dihydroindol-1-yl]-(5-nitro-1H-indazol-3-yl)methanone.
| Compound Name | [(2R)-2-methyl-2,3-dihydroindol-1-yl]-(5-nitro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 35414080 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [(2R)-2-methyl-2,3-dihydroindol-1-yl]-(5-nitro-1H-indazol-3-yl)methanone |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H14N4O3/c1-10-8-11-4-2-3-5-15(11)20(10)17(22)16-13-9-12(21(23)24)6-7-14(13)18-19-16/h2-7,9-10H,8H2,1H3,(H,18,19)/t10-/m1/s1 |
| InChIKey | AQLRQIBJCVMFBI-SNVBAGLBSA-N |
| XLogP | 3.06 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|