C22H19N3O4 — CID 43995791
3-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-[(3-nitrophenyl)methyl]pyridin-2-one (PubChem CID 43995791) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-[(3-nitrophenyl)methyl]pyridin-2-one.
| Compound Name | 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-[(3-nitrophenyl)methyl]pyridin-2-one |
|---|---|
| PubChem CID | 43995791 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(2-methyl-2,3-dihydroindole-1-carbonyl)-1-[(3-nitrophenyl)methyl]pyridin-2-one |
| SMILES | CC1Cc2ccccc2N1C(=O)c1cccn(Cc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C22H19N3O4/c1-15-12-17-7-2-3-10-20(17)24(15)22(27)19-9-5-11-23(21(19)26)14-16-6-4-8-18(13-16)25(28)29/h2-11,13,15H,12,14H2,1H3 |
| InChIKey | PGEKFCHNUKPPQV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|