C14H18ClN5O3 — CID 120571128
(2,3-dimethylpiperazin-1-yl)-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride (PubChem CID 120571128) has the molecular formula C14H18ClN5O3 and a molecular weight of 339.78 g/mol. Its IUPAC name is (2,3-dimethylpiperazin-1-yl)-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride.
| Compound Name | (2,3-dimethylpiperazin-1-yl)-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120571128 |
| Molecular Formula | C14H18ClN5O3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2,3-dimethylpiperazin-1-yl)-(5-nitro-1H-indazol-3-yl)methanone;hydrochloride |
| SMILES | CC1NCCN(C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)C1C.Cl |
| InChI | InChI=1S/C14H17N5O3.ClH/c1-8-9(2)18(6-5-15-8)14(20)13-11-7-10(19(21)22)3-4-12(11)16-17-13;/h3-4,7-9,15H,5-6H2,1-2H3,(H,16,17);1H |
| InChIKey | GSDPIFFFWLVBNX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|