C15H22ClN3O3 — CID 120572423
1-(2,3-dimethylpiperazin-1-yl)-3-(3-nitrophenyl)propan-1-one;hydrochloride (PubChem CID 120572423) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-(2,3-dimethylpiperazin-1-yl)-3-(3-nitrophenyl)propan-1-one;hydrochloride.
| Compound Name | 1-(2,3-dimethylpiperazin-1-yl)-3-(3-nitrophenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120572423 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(2,3-dimethylpiperazin-1-yl)-3-(3-nitrophenyl)propan-1-one;hydrochloride |
| SMILES | CC1NCCN(C(=O)CCc2cccc([N+](=O)[O-])c2)C1C.Cl |
| InChI | InChI=1S/C15H21N3O3.ClH/c1-11-12(2)17(9-8-16-11)15(19)7-6-13-4-3-5-14(10-13)18(20)21;/h3-5,10-12,16H,6-9H2,1-2H3;1H |
| InChIKey | CFKCIAPUFHDVHA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|