C15H23N3O — CID 122081287
3-(2-aminophenyl)-1-(2,3-dimethylpiperazin-1-yl)propan-1-one (PubChem CID 122081287) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-(2,3-dimethylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(2-aminophenyl)-1-(2,3-dimethylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 122081287 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 3-(2-aminophenyl)-1-(2,3-dimethylpiperazin-1-yl)propan-1-one |
| SMILES | CC1NCCN(C(=O)CCc2ccccc2N)C1C |
| InChI | InChI=1S/C15H23N3O/c1-11-12(2)18(10-9-17-11)15(19)8-7-13-5-3-4-6-14(13)16/h3-6,11-12,17H,7-10,16H2,1-2H3 |
| InChIKey | DXZYFRZIDUAZKF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|