C16H24BrClN2O2 — CID 120572545
4-(2-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)butan-1-one;hydrochloride (PubChem CID 120572545) has the molecular formula C16H24BrClN2O2 and a molecular weight of 391.74 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)butan-1-one;hydrochloride.
| Compound Name | 4-(2-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120572545 |
| Molecular Formula | C16H24BrClN2O2 |
| Molecular Weight | 391.74 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-(2-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)butan-1-one;hydrochloride |
| SMILES | CC1NCCN(C(=O)CCCOc2ccccc2Br)C1C.Cl |
| InChI | InChI=1S/C16H23BrN2O2.ClH/c1-12-13(2)19(10-9-18-12)16(20)8-5-11-21-15-7-4-3-6-14(15)17;/h3-4,6-7,12-13,18H,5,8-11H2,1-2H3;1H |
| InChIKey | LCXSZPALLHUZJW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|