C14H19BrN2O2 — CID 120569813
2-(3-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)ethanone (PubChem CID 120569813) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-(3-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 120569813 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-(3-bromophenoxy)-1-(2,3-dimethylpiperazin-1-yl)ethanone |
| SMILES | CC1NCCN(C(=O)COc2cccc(Br)c2)C1C |
| InChI | InChI=1S/C14H19BrN2O2/c1-10-11(2)17(7-6-16-10)14(18)9-19-13-5-3-4-12(15)8-13/h3-5,8,10-11,16H,6-7,9H2,1-2H3 |
| InChIKey | PZRWGCQPRNTFKL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |