C15H18N2O5 — CID 120953330
(3S,4S)-4-methyl-1-[3-(3-nitrophenyl)propanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 120953330) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (3S,4S)-4-methyl-1-[3-(3-nitrophenyl)propanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-methyl-1-[3-(3-nitrophenyl)propanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120953330 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (3S,4S)-4-methyl-1-[3-(3-nitrophenyl)propanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)CCc2cccc([N+](=O)[O-])c2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C15H18N2O5/c1-10-8-16(9-13(10)15(19)20)14(18)6-5-11-3-2-4-12(7-11)17(21)22/h2-4,7,10,13H,5-6,8-9H2,1H3,(H,19,20)/t10-,13-/m1/s1 |
| InChIKey | PYEDAGONHZZFJS-ZWNOBZJWSA-N |
| XLogP | 1.71 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|