C16H14N6O4S — CID 60524660
1-(5-nitro-1H-indazole-3-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 60524660) has the molecular formula C16H14N6O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is 1-(5-nitro-1H-indazole-3-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-nitro-1H-indazole-3-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60524660 |
| Molecular Formula | C16H14N6O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-(5-nitro-1H-indazole-3-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN1C(=O)c1n[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C16H14N6O4S/c23-14(18-16-17-5-7-27-16)12-2-1-6-21(12)15(24)13-10-8-9(22(25)26)3-4-11(10)19-20-13/h3-5,7-8,12H,1-2,6H2,(H,19,20)(H,17,18,23) |
| InChIKey | WDQNKTRSNNOMJA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|