C10H11N3O2 — CID 600712
4-nitro-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (PubChem CID 600712) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-nitro-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 4-nitro-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 600712 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-nitro-1,8-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)N1CCN2CC1 |
| InChI | InChI=1S/C10H11N3O2/c14-13(15)8-1-2-9-10(7-8)12-5-3-11(9)4-6-12/h1-2,7H,3-6H2 |
| InChIKey | FDSGCBWGOUINFS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|