C12H14N6O2 — CID 56737324
1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperazine (PubChem CID 56737324) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperazine.
| Compound Name | 1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 56737324 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCNCC2)c(-n2cnnc2)c1 |
| InChI | InChI=1S/C12H14N6O2/c19-18(20)10-1-2-11(16-5-3-13-4-6-16)12(7-10)17-8-14-15-9-17/h1-2,7-9,13H,3-6H2 |
| InChIKey | SYVHOGOTTHGVNP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|