C14H17N7O2 — CID 175308843
2-(5-nitro-2-piperazin-1-ylphenyl)pyrimidine-4,5-diamine (PubChem CID 175308843) has the molecular formula C14H17N7O2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-(5-nitro-2-piperazin-1-ylphenyl)pyrimidine-4,5-diamine.
| Compound Name | 2-(5-nitro-2-piperazin-1-ylphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 175308843 |
| Molecular Formula | C14H17N7O2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-(5-nitro-2-piperazin-1-ylphenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cnc(-c2cc([N+](=O)[O-])ccc2N2CCNCC2)nc1N |
| InChI | InChI=1S/C14H17N7O2/c15-11-8-18-14(19-13(11)16)10-7-9(21(22)23)1-2-12(10)20-5-3-17-4-6-20/h1-2,7-8,17H,3-6,15H2,(H2,16,18,19) |
| InChIKey | WRZRMTYFLJYORQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|