C16H18N6O2 — CID 59277047
5-nitro-1-(6-piperazin-1-ylpyridazin-3-yl)-2,3-dihydroindole (PubChem CID 59277047) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-nitro-1-(6-piperazin-1-ylpyridazin-3-yl)-2,3-dihydroindole.
| Compound Name | 5-nitro-1-(6-piperazin-1-ylpyridazin-3-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 59277047 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-nitro-1-(6-piperazin-1-ylpyridazin-3-yl)-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CCN2c1ccc(N2CCNCC2)nn1 |
| InChI | InChI=1S/C16H18N6O2/c23-22(24)13-1-2-14-12(11-13)5-8-21(14)16-4-3-15(18-19-16)20-9-6-17-7-10-20/h1-4,11,17H,5-10H2 |
| InChIKey | IWEMEZZQXIWGCN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|