C17H14N4O2 — CID 143177758
2-methyl-4-(5-nitro-2,3-dihydroindol-1-yl)quinazoline (PubChem CID 143177758) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-methyl-4-(5-nitro-2,3-dihydroindol-1-yl)quinazoline.
| Compound Name | 2-methyl-4-(5-nitro-2,3-dihydroindol-1-yl)quinazoline |
|---|---|
| PubChem CID | 143177758 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-methyl-4-(5-nitro-2,3-dihydroindol-1-yl)quinazoline |
| SMILES | Cc1nc(N2CCc3cc([N+](=O)[O-])ccc32)c2ccccc2n1 |
| InChI | InChI=1S/C17H14N4O2/c1-11-18-15-5-3-2-4-14(15)17(19-11)20-9-8-12-10-13(21(22)23)6-7-16(12)20/h2-7,10H,8-9H2,1H3 |
| InChIKey | AQGOHOIBYGTNCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|