C14H9N5O4S — CID 135390445
7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid (PubChem CID 135390445) has the molecular formula C14H9N5O4S and a molecular weight of 343.32 g/mol. Its IUPAC name is 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid.
| Compound Name | 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 135390445 |
| Molecular Formula | C14H9N5O4S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 7-(5-nitro-2,3-dihydroindol-1-yl)-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1nc2c(N3CCc4cc([N+](=O)[O-])ccc43)ncnc2s1 |
| InChI | InChI=1S/C14H9N5O4S/c20-14(21)13-17-10-11(15-6-16-12(10)24-13)18-4-3-7-5-8(19(22)23)1-2-9(7)18/h1-2,5-6H,3-4H2,(H,20,21) |
| InChIKey | CITAHJDTNLJKEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|