C14H17N5O2 — CID 95362194
(2R)-2-methyl-1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperidine (PubChem CID 95362194) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2R)-2-methyl-1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperidine.
| Compound Name | (2R)-2-methyl-1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 95362194 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (2R)-2-methyl-1-[4-nitro-2-(1,2,4-triazol-4-yl)phenyl]piperidine |
| SMILES | C[C@@H]1CCCCN1c1ccc([N+](=O)[O-])cc1-n1cnnc1 |
| InChI | InChI=1S/C14H17N5O2/c1-11-4-2-3-7-18(11)13-6-5-12(19(20)21)8-14(13)17-9-15-16-10-17/h5-6,8-11H,2-4,7H2,1H3/t11-/m1/s1 |
| InChIKey | IXKJQJMQNWAJOC-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|