C24H29N3O2 — CID 93118755
(4aR,5S)-N-cyclopropyl-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 93118755) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is (4aR,5S)-N-cyclopropyl-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5S)-N-cyclopropyl-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 93118755 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (4aR,5S)-N-cyclopropyl-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1Cc2ccccc2N2CCN(CCOc3ccccc3)C[C@@H]12 |
| InChI | InChI=1S/C24H29N3O2/c28-24(25-19-10-11-19)21-16-18-6-4-5-9-22(18)27-13-12-26(17-23(21)27)14-15-29-20-7-2-1-3-8-20/h1-9,19,21,23H,10-17H2,(H,25,28)/t21-,23-/m0/s1 |
| InChIKey | GINNXDMPBGHAJA-GMAHTHKFSA-N |
| XLogP | 2.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |