C27H34N4O5 — CID 99728418
[(4aR,5R)-8-nitro-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 99728418) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is [(4aR,5R)-8-nitro-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [(4aR,5R)-8-nitro-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 99728418 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | [(4aR,5R)-8-nitro-3-(2-phenoxyethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinolin-5-yl]-[(2R,6S)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)[C@@H]2Cc3cc([N+](=O)[O-])ccc3N3CCN(CCOc4ccccc4)C[C@@H]23)C[C@H](C)O1 |
| InChI | InChI=1S/C27H34N4O5/c1-19-16-29(17-20(2)36-19)27(32)24-15-21-14-22(31(33)34)8-9-25(21)30-11-10-28(18-26(24)30)12-13-35-23-6-4-3-5-7-23/h3-9,14,19-20,24,26H,10-13,15-18H2,1-2H3/t19-,20+,24-,26+/m1/s1 |
| InChIKey | QESBQKYMLSXDOW-WNBHKESASA-N |
| XLogP | 2.97 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|