C26H28ClN3O2S — CID 98623962
(4aR,5R)-3-(5-chloro-2-methoxyphenyl)-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 98623962) has the molecular formula C26H28ClN3O2S and a molecular weight of 482.05 g/mol. Its IUPAC name is (4aR,5R)-3-(5-chloro-2-methoxyphenyl)-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aR,5R)-3-(5-chloro-2-methoxyphenyl)-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 98623962 |
| Molecular Formula | C26H28ClN3O2S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (4aR,5R)-3-(5-chloro-2-methoxyphenyl)-N-(2-thiophen-2-ylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc(Cl)cc1N1CCN2c3ccccc3C[C@@H](C(=O)NCCc3cccs3)[C@@H]2C1 |
| InChI | InChI=1S/C26H28ClN3O2S/c1-32-25-9-8-19(27)16-23(25)29-12-13-30-22-7-3-2-5-18(22)15-21(24(30)17-29)26(31)28-11-10-20-6-4-14-33-20/h2-9,14,16,21,24H,10-13,15,17H2,1H3,(H,28,31)/t21-,24+/m1/s1 |
| InChIKey | TZVUWCONJAIVCE-QPPBQGQZSA-N |
| XLogP | 4.64 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |