C29H33N3O2 — CID 100897892
(4aS,5R)-9-methoxy-3-(4-methylphenyl)-N-[(1S)-1-phenylethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide (PubChem CID 100897892) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is (4aS,5R)-9-methoxy-3-(4-methylphenyl)-N-[(1S)-1-phenylethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide.
| Compound Name | (4aS,5R)-9-methoxy-3-(4-methylphenyl)-N-[(1S)-1-phenylethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
|---|---|
| PubChem CID | 100897892 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | (4aS,5R)-9-methoxy-3-(4-methylphenyl)-N-[(1S)-1-phenylethyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carboxamide |
| SMILES | COc1ccc2c(c1)N1CCN(c3ccc(C)cc3)C[C@@H]1[C@H](C(=O)N[C@@H](C)c1ccccc1)C2 |
| InChI | InChI=1S/C29H33N3O2/c1-20-9-12-24(13-10-20)31-15-16-32-27-18-25(34-3)14-11-23(27)17-26(28(32)19-31)29(33)30-21(2)22-7-5-4-6-8-22/h4-14,18,21,26,28H,15-17,19H2,1-3H3,(H,30,33)/t21-,26+,28+/m0/s1 |
| InChIKey | OOEQQMRMPXHARZ-GGPAXRDESA-N |
| XLogP | 4.75 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|